|
CAS#: 942043-17-6 Product: 4-Methylphenyl 1-thio-2,3,4,6-tetrakis-O-(trimethylsilyl)-beta-D-glucopyranoside No suppilers available for the product. |
| Name | 4-Methylphenyl 1-thio-2,3,4,6-tetrakis-O-(trimethylsilyl)-beta-D-glucopyranoside |
|---|---|
| Synonyms | p-Tolyl 1 |
| Molecular Structure | ![]() |
| Molecular Formula | C25H50O5SSi4 |
| Molecular Weight | 575.07 |
| CAS Registry Number | 942043-17-6 |
| SMILES | Cc1ccc(cc1)SC2C(C(C(C(O2)CO[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | 1S/C25H50O5SSi4/c1-19-14-16-20(17-15-19)31-25-24(30-35(11,12)13)23(29-34(8,9)10)22(28-33(5,6)7)21(27-25)18-26-32(2,3)4/h14-17,21-25H,18H2,1-13H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | FVWMHGKJMGETAM-RXFVIIJJSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.066°C at 760 mmHg (Cal.) |
| Flash point | 258.65°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| (1) | Hu et al.. Synthesis of 3-O-sulfonated heparan sulfate octasaccharides that inhibit the herpes simplex virus type 1 host-cell interaction, Nature Chemistry, 2011 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methylphenyl 1-thio-2,3,4,6-tetrakis-O-(trimethylsilyl)-beta-D-glucopyranoside |