|
CAS#: 94213-55-5 Product: 1-(3,4-Dimethoxybenzyl)-6,7-dimethoxy-2,3-dihydroisoquinoline No suppilers available for the product. |
| Name | 1-(3,4-Dimethoxybenzyl)-6,7-dimethoxy-2,3-dihydroisoquinoline |
|---|---|
| Synonyms | NSC99802 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40 |
| CAS Registry Number | 94213-55-5 |
| EINECS | 303-759-9 |
| SMILES | O(c1ccc(cc1OC)CC\3=C2/C=C(/OC)\C(\OC)=C/C2=C/CN/3)C |
| InChI | 1S/C20H23NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-7,10-12,21H,8-9H2,1-4H3 |
| InChIKey | IKZYPGQHZBTYBP-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.245°C at 760 mmHg (Cal.) |
| Flash point | 239.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dimethoxybenzyl)-6,7-dimethoxy-2,3-dihydroisoquinoline |