| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BoroChem | France | Inquire | ||
|---|---|---|---|---|
![]() |
+33 (2) 3194-5073 | |||
![]() |
info@borochem.fr | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2',5-Dichloro-2,4'-bipyridine |
|---|---|
| Synonyms | 5,2'-DICHLORO-[2,4']-BIPYRIDINE; 5,2'-Dichloro-2,4'-bipyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.07 |
| CAS Registry Number | 942206-21-5 |
| SMILES | C1=CC(=NC=C1Cl)C2=CC(=NC=C2)Cl |
| InChI | 1S/C10H6Cl2N2/c11-8-1-2-9(14-6-8)7-3-4-13-10(12)5-7/h1-6H |
| InChIKey | BKYODZNCPNKPOB-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| 1.303-1.423 (Expl.) | |
| Boiling point | 333.8±37.0°C at 760 mmHg (Cal.) |
| Flash point | 185.9±12.1°C (Cal.) |
| Refractive index | 1.605 (Cal.) |
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R22;R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| Market Analysis Reports |
| List of Reports Available for 2',5-Dichloro-2,4'-bipyridine |