|
CAS#: 94230-82-7 Product: (2S)-2-[(2-bromo-4-methyl-pentanoyl)amino]-4-methyl-pentanoic acid No suppilers available for the product. |
| Name | (2S)-2-[(2-bromo-4-methyl-pentanoyl)amino]-4-methyl-pentanoic acid |
|---|---|
| Synonyms | N-(2-bromo-4-methyl-1-oxopentyl)-DL-leucine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22BrNO3 |
| Molecular Weight | 308.21 |
| CAS Registry Number | 94230-82-7 |
| EINECS | 303-793-4 |
| SMILES | O=C(N[C@@H](CC(C)C)C(O)=O)C(Br)CC(C)C |
| InChI | 1S/C12H22BrNO3/c1-7(2)5-9(13)11(15)14-10(12(16)17)6-8(3)4/h7-10H,5-6H2,1-4H3,(H,14,15)(H,16,17)/t9?,10-/m0/s1 |
| InChIKey | SKIOHEOZWHHOCD-AXDSSHIGSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.829°C at 760 mmHg (Cal.) |
| Flash point | 218.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-[(2-bromo-4-methyl-pentanoyl)amino]-4-methyl-pentanoic acid |