|
CAS#: 94231-62-6 Product: 2,6-Di-tert-Butyl-3-Ethylphenol No suppilers available for the product. |
| Name | 2,6-Di-tert-Butyl-3-Ethylphenol |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-3-Ethyl-Phenol; 2,6-Di-Tert-Butyl-3-Ethylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 94231-62-6 |
| EINECS | 303-881-2 |
| SMILES | C1=C(C(C)(C)C)C(=C(C(C)(C)C)C(=C1)CC)O |
| InChI | 1S/C16H26O/c1-8-11-9-10-12(15(2,3)4)14(17)13(11)16(5,6)7/h9-10,17H,8H2,1-7H3 |
| InChIKey | SJJNVHBNVQEDBA-UHFFFAOYSA-N |
| Density | 0.923g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.334°C at 760 mmHg (Cal.) |
| Flash point | 126.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Di-tert-Butyl-3-Ethylphenol |