|
CAS#: 94232-72-1 Product: Triethoxy[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane No suppilers available for the product. |
| Name | Triethoxy[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane |
|---|---|
| Synonyms | Triethoxy(3-(1,1,2,2-Tetrafluoroethoxy)Propyl)Silane |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22F4O4Si |
| Molecular Weight | 322.37 |
| CAS Registry Number | 94232-72-1 |
| EINECS | 304-000-4 |
| SMILES | C([Si](OCC)(OCC)OCC)CCOC(F)(F)C(F)F |
| InChI | 1S/C11H22F4O4Si/c1-4-17-20(18-5-2,19-6-3)9-7-8-16-11(14,15)10(12)13/h10H,4-9H2,1-3H3 |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.098°C at 760 mmHg (Cal.) |
| Flash point | 110.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triethoxy[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane |