|
CAS#: 94247-75-3 Product: 1,3-Diisobutylnaphthalene-2-Sulphonic Acid No suppilers available for the product. |
| Name | 1,3-Diisobutylnaphthalene-2-Sulphonic Acid |
|---|---|
| Synonyms | 1,3-Diisobutylnaphthalene-2-Sulfonic Acid; 1,3-Diisobutyl-2-Naphthalenesulfonic Acid; Diisobutylnaphthalene-2-Sulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 |
| CAS Registry Number | 94247-75-3 |
| EINECS | 304-245-7 |
| SMILES | C1=C(C(=C(C2=C1C=CC=C2)CC(C)C)[S](=O)(=O)O)CC(C)C |
| InChI | 1S/C18H24O3S/c1-12(2)9-15-11-14-7-5-6-8-16(14)17(10-13(3)4)18(15)22(19,20)21/h5-8,11-13H,9-10H2,1-4H3,(H,19,20,21) |
| InChIKey | UTDRFZYLWMKWGN-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Diisobutylnaphthalene-2-Sulphonic Acid |