|
CAS#: 94249-03-3 Product: N-(4-chlorophenyl)-2-[4-[4-[1-[(4-chlorophenyl)carbamoyl]-2-oxo-propyl]azophenyl]phenyl]azo-3-oxo-butanamide No suppilers available for the product. |
| Name | N-(4-chlorophenyl)-2-[4-[4-[1-[(4-chlorophenyl)carbamoyl]-2-oxo-propyl]azophenyl]phenyl]azo-3-oxo-butanamide |
|---|---|
| Synonyms | 2,2'-[[1, |
| Molecular Structure | ![]() |
| Molecular Formula | C32H26Cl2N6O4 |
| Molecular Weight | 629.49 |
| CAS Registry Number | 94249-03-3 |
| EINECS | 304-380-1 |
| SMILES | Clc4ccc(NC(=O)C(N=Nc1ccc(cc1)c3ccc(N=NC(C(C)=O)C(=O)Nc2ccc(Cl)cc2)cc3)C(C)=O)cc4 |
| InChI | 1S/C32H26Cl2N6O4/c1-19(41)29(31(43)35-25-15-7-23(33)8-16-25)39-37-27-11-3-21(4-12-27)22-5-13-28(14-6-22)38-40-30(20(2)42)32(44)36-26-17-9-24(34)10-18-26/h3-18,29-30H,1-2H3,(H,35,43)(H,36,44) |
| InChIKey | UPSAJZSSQKUOAT-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 789.827°C at 760 mmHg (Cal.) |
| Flash point | 431.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-chlorophenyl)-2-[4-[4-[1-[(4-chlorophenyl)carbamoyl]-2-oxo-propyl]azophenyl]phenyl]azo-3-oxo-butanamide |