|
CAS#: 94251-83-9 Product: 5-Ethyl-2-(3-Nitrophenyl)-4-Propyl-1,3-Dioxane No suppilers available for the product. |
| Name | 5-Ethyl-2-(3-Nitrophenyl)-4-Propyl-1,3-Dioxane |
|---|---|
| Synonyms | Nsc48560 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 |
| CAS Registry Number | 94251-83-9 |
| SMILES | C1=CC=C(C=C1C2OC(C(CC)CO2)CCC)[N+]([O-])=O |
| InChI | 1S/C15H21NO4/c1-3-6-14-11(4-2)10-19-15(20-14)12-7-5-8-13(9-12)16(17)18/h5,7-9,11,14-15H,3-4,6,10H2,1-2H3 |
| InChIKey | YXYUHCQYBBQVNQ-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.335°C at 760 mmHg (Cal.) |
| Flash point | 147.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-2-(3-Nitrophenyl)-4-Propyl-1,3-Dioxane |