Online Database of Chemicals from Around the World
|
CAS#: 94266-23-6 Product: [(2-methyl-4-nitro-phenyl)hydrazono]cyanamide No suppilers available for the product. |
| Name | [(2-methyl-4-nitro-phenyl)hydrazono]cyanamide |
|---|---|
| Synonyms | 3-(2-methyl-4-nitrophenyl)-1-triazene-1-carbonitrile |
| Molecular Structure | ![CAS#: 94266-23-6, [(2-methyl-4-nitro-phenyl)hydrazono]cyanamide](/moreStructures/94266-23-6.gif) |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.17 |
| CAS Registry Number | 94266-23-6 |
| EINECS | 304-429-7 |
| SMILES | [O-][N+](=O)c1ccc(NN=NC#N)c(C)c1 |
| InChI | 1S/C8H7N5O2/c1-6-4-7(13(14)15)2-3-8(6)11-12-10-5-9/h2-4H,1H3,(H,10,11) |
| InChIKey | BSAGCFIQELKZPY-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.034°C at 760 mmHg (Cal.) |
| Flash point | 158.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2-methyl-4-nitro-phenyl)hydrazono]cyanamide |