|
CAS#: 94275-80-6 Product: 7-Bromo-5-Chloroquinolin-Ol No suppilers available for the product. |
| Name | 7-Bromo-5-Chloroquinolin-Ol |
|---|---|
| Synonyms | 7-Bromo-5-Chloro-Carbostyril; 7-Bromo-5-Chloroquinolin-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5BrClNO |
| Molecular Weight | 258.50 |
| CAS Registry Number | 94275-80-6 |
| EINECS | 304-469-5 |
| SMILES | C1=C(Br)C=C(Cl)C2=C1NC(=O)C=C2 |
| InChI | 1S/C9H5BrClNO/c10-5-3-7(11)6-1-2-9(13)12-8(6)4-5/h1-4H,(H,12,13) |
| InChIKey | AFLLVELQLSQJHK-UHFFFAOYSA-N |
| Density | 1.721g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.493°C at 760 mmHg (Cal.) |
| Flash point | 193.592°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Bromo-5-Chloroquinolin-Ol |