|
CAS#: 94277-40-4 Product: Ethyl Ethylbis(2-Ethylhexyl)Methylammonium Sulphate No suppilers available for the product. |
| Name | Ethyl Ethylbis(2-Ethylhexyl)Methylammonium Sulphate |
|---|---|
| Synonyms | [1,3-Diethyl-1-(2-Ethylhexyl)Heptyl]-Ethyl-Ammonium Sulfate; [1,3-Diethyl-1-(2-Ethylhexyl)Heptyl]-Ethylammonium Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H46NO4S |
| Molecular Weight | 408.66 |
| CAS Registry Number | 94277-40-4 |
| EINECS | 304-623-1 |
| SMILES | O=[S]([O-])([O-])=O.C(C([NH2+]CC)(CC(CCCC)CC)CC)C(CCCC)CC |
| InChI | 1S/C21H45N.H2O4S/c1-7-13-15-19(9-3)17-21(11-5,22-12-6)18-20(10-4)16-14-8-2;1-5(2,3)4/h19-20,22H,7-18H2,1-6H3;(H2,1,2,3,4)/p-1 |
| InChIKey | LWHLFFXCVQAJKH-UHFFFAOYSA-M |
| Boiling point | 506.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 260.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Ethylbis(2-Ethylhexyl)Methylammonium Sulphate |