|
CAS#: 94278-20-3 Product: 2-[[1-(2-furylmethoxy)-2-methyl-propoxy]methyl]furan No suppilers available for the product. |
| Name | 2-[[1-(2-furylmethoxy)-2-methyl-propoxy]methyl]furan |
|---|---|
| Synonyms | 2,2'-[(2-methylpropylidene)bis(oxymethylene)]bisfuran |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 |
| CAS Registry Number | 94278-20-3 |
| EINECS | 304-708-3 |
| SMILES | CC(C)C(OCc1ccco1)OCc2ccco2 |
| InChI | 1S/C14H18O4/c1-11(2)14(17-9-12-5-3-7-15-12)18-10-13-6-4-8-16-13/h3-8,11,14H,9-10H2,1-2H3 |
| InChIKey | AAYXEQGKAQUIMA-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.039°C at 760 mmHg (Cal.) |
| Flash point | 151.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[1-(2-furylmethoxy)-2-methyl-propoxy]methyl]furan |