|
CAS#: 94291-56-2 Product: 4,4,6-Trimethyl-2-[1-Methyl-2-[4-(1-Methylethyl)Phenyl]Ethyl]-1,3-Dioxane No suppilers available for the product. |
| Name | 4,4,6-Trimethyl-2-[1-Methyl-2-[4-(1-Methylethyl)Phenyl]Ethyl]-1,3-Dioxane |
|---|---|
| Synonyms | 2-[2-(4-Isopropylphenyl)-1-Methyl-Ethyl]-4,4,6-Trimethyl-1,3-Dioxane; 2-[2-(4-Isopropylphenyl)-1-Methylethyl]-4,4,6-Trimethyl-1,3-Dioxane; 4,4,6-Trimethyl-2-(1-Methyl-2-(4-(1-Methylethyl)Phenyl)Ethyl)-1,3-Dioxane |
| Molecular Structure | ![]() |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.44 |
| CAS Registry Number | 94291-56-2 |
| EINECS | 304-881-5 |
| SMILES | C2=C(CC(C1OC(CC(O1)C)(C)C)C)C=CC(=C2)C(C)C |
| InChI | 1S/C19H30O2/c1-13(2)17-9-7-16(8-10-17)11-14(3)18-20-15(4)12-19(5,6)21-18/h7-10,13-15,18H,11-12H2,1-6H3 |
| InChIKey | HMBQDSPREBNWHZ-UHFFFAOYSA-N |
| Density | 0.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.967°C at 760 mmHg (Cal.) |
| Flash point | 190.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,6-Trimethyl-2-[1-Methyl-2-[4-(1-Methylethyl)Phenyl]Ethyl]-1,3-Dioxane |