|
CAS#: 94291-81-3 Product: 1-(3,4-diisopropylphenyl)ethanone No suppilers available for the product. |
| Name | 1-(3,4-diisopropylphenyl)ethanone |
|---|---|
| Synonyms | 1-[3,4-bis(1-methylethyl)phenyl]ethan-1-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 94291-81-3 |
| EINECS | 304-908-0 |
| SMILES | CC(C)c1cc(ccc1C(C)C)C(C)=O |
| InChI | 1S/C14H20O/c1-9(2)13-7-6-12(11(5)15)8-14(13)10(3)4/h6-10H,1-5H3 |
| InChIKey | ZDINBUUATIMDHJ-UHFFFAOYSA-N |
| Density | 0.924g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.921°C at 760 mmHg (Cal.) |
| Flash point | 118.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-diisopropylphenyl)ethanone |