|
CAS#: 94313-54-9 Product: Lithium 4-Ethylhexanoate No suppilers available for the product. |
| Name | Lithium 4-Ethylhexanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H15LiO2 |
| Molecular Weight | 150.15 |
| CAS Registry Number | 94313-54-9 |
| EINECS | 304-953-6 |
| SMILES | C(C(CC)CC)CC([O-])=O.[Li+] |
| InChI | 1S/C8H16O2.Li/c1-3-7(4-2)5-6-8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | XMSZNLYHBMXYJW-UHFFFAOYSA-M |
| Boiling point | 234.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium 4-Ethylhexanoate |