|
CAS#: 94314-00-8 Product: O-Methyl-L-Cysteine 1,2,3,6-Tetrahydro-2,6-Dioxopyrimidine-4-Carboxylate No suppilers available for the product. |
| Name | O-Methyl-L-Cysteine 1,2,3,6-Tetrahydro-2,6-Dioxopyrimidine-4-Carboxylate |
|---|---|
| Synonyms | O-methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3O6S |
| Molecular Weight | 291.28 |
| CAS Registry Number | 94314-00-8 |
| EINECS | 305-000-7 |
| SMILES | O=C(O)C1=CC(=O)NC(=O)N1.COC(=O)[C@@H](N)CS |
| InChI | 1S/C5H4N2O4.C4H9NO2S/c8-3-1-2(4(9)10)6-5(11)7-3;1-7-4(6)3(5)2-8/h1H,(H,9,10)(H2,6,7,8,11);3,8H,2,5H2,1H3/t;3-/m.0/s1 |
| InChIKey | ZVCBBVSXQDAGFX-HVDRVSQOSA-N |
| Boiling point | 463.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 234.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Methyl-L-Cysteine 1,2,3,6-Tetrahydro-2,6-Dioxopyrimidine-4-Carboxylate |