|
CAS#: 94333-07-0 Product: 9-Benzyl-6-Benzylsulfanyl-Purin-2-Amine No suppilers available for the product. |
| Name | 9-Benzyl-6-Benzylsulfanyl-Purin-2-Amine |
|---|---|
| Synonyms | 9-(Phenylmethyl)-6-(Phenylmethylthio)-2-Purinamine; [9-(Benzyl)-6-(Benzylthio)Purin-2-Yl]Amine; Nci42384 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.44 |
| CAS Registry Number | 94333-07-0 |
| SMILES | C3=NC1=C(N=C(N)N=C1SCC2=CC=CC=C2)[N]3CC4=CC=CC=C4 |
| InChI | 1S/C19H17N5S/c20-19-22-17-16(18(23-19)25-12-15-9-5-2-6-10-15)21-13-24(17)11-14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H2,20,22,23) |
| InChIKey | DNNVKRLIFZPYGL-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 636.777°C at 760 mmHg (Cal.) |
| Flash point | 338.911°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Benzyl-6-Benzylsulfanyl-Purin-2-Amine |