|
CAS#: 94386-39-7 Product: 2-Methyl-5-(1-Methylvinyl)-2-Cyclohexen-1-Yl Isovalerate No suppilers available for the product. |
| Name | 2-Methyl-5-(1-Methylvinyl)-2-Cyclohexen-1-Yl Isovalerate |
|---|---|
| Synonyms | (5-Isopropenyl-2-Methyl-1-Cyclohex-2-Enyl) 3-Methylbutanoate; 3-Methylbutanoic Acid (5-Isopropenyl-2-Methyl-1-Cyclohex-2-Enyl) Ester; 3-Methylbutyric Acid (5-Isopropenyl-2-Methyl-1-Cyclohex-2-Enyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 |
| CAS Registry Number | 94386-39-7 |
| EINECS | 305-261-7 |
| SMILES | C(C(OC1C(=CCC(C1)C(=C)C)C)=O)C(C)C |
| InChI | 1S/C15H24O2/c1-10(2)8-15(16)17-14-9-13(11(3)4)7-6-12(14)5/h6,10,13-14H,3,7-9H2,1-2,4-5H3 |
| InChIKey | GGESQBHSIRCDBW-UHFFFAOYSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.707°C at 760 mmHg (Cal.) |
| Flash point | 125.733°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-(1-Methylvinyl)-2-Cyclohexen-1-Yl Isovalerate |