|
CAS#: 94386-64-8 Product: Trans-3-Vinylcyclohexyl Acetate No suppilers available for the product. |
| Name | Trans-3-Vinylcyclohexyl Acetate |
|---|---|
| Synonyms | [(1R,3R)-3-Vinylcyclohexyl] Acetate; Acetic Acid [(1R,3R)-3-Vinylcyclohexyl] Ester; [(1R,3R)-3-Ethenylcyclohexyl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 94386-64-8 |
| EINECS | 305-287-9 |
| SMILES | [C@H]1(OC(C)=O)C[C@@H](CCC1)C=C |
| InChI | 1S/C10H16O2/c1-3-9-5-4-6-10(7-9)12-8(2)11/h3,9-10H,1,4-7H2,2H3/t9-,10-/m1/s1 |
| InChIKey | MFFQZYIDSYOHOP-NXEZZACHSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 206.353°C at 760 mmHg (Cal.) |
| Flash point | 69.16°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trans-3-Vinylcyclohexyl Acetate |