Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (755) 3323-9182 ex 801 802 // +86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Tricyclo[5.2.1.02,6]decane-3-carbonyl chloride |
|---|---|
| Synonyms | octahydro-1H-4,7-methanoindene-1-carbonyl chloride |
| Molecular Structure | ![CAS#: 94487-60-2, Tricyclo[5.2.1.0<sup>2,6</sup>]decane-3-carbonyl chloride](/moreStructures/94487-60-2.gif) |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 |
| CAS Registry Number | 94487-60-2 |
| SMILES | C1CC2CC1C3C2C(CC3)C(=O)Cl |
| InChI | 1S/C11H15ClO/c12-11(13)9-4-3-8-6-1-2-7(5-6)10(8)9/h6-10H,1-5H2 |
| InChIKey | XWCUZMFJCXUPQD-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.02°C at 760 mmHg (Cal.) |
| Flash point | 144.866°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tricyclo[5.2.1.02,6]decane-3-carbonyl chloride |