|
CAS#: 945494-72-4 Product: (1R,7S)-4,10-Dioxatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione No suppilers available for the product. |
| Name | (1R,7S)-4,10-Dioxatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione |
|---|---|
| Synonyms | 4,5,6,7-Tetrahydro-4,7-epoxyisobenzofuran-1,3-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 |
| CAS Registry Number | 945494-72-4 |
| SMILES | C1C[C@H]2C3=C([C@@H]1O2)C(=O)OC3=O |
| InChI | 1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h3-4H,1-2H2/t3-,4+ |
| InChIKey | IRGCBQMAFUJTJA-ZXZARUISSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 170.4±27.9°C (Cal.) |
| Refractive index | 1.597 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,7S)-4,10-Dioxatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione |