Online Database of Chemicals from Around the World
|
CAS#: 945860-88-8 Product: 2-Chloro-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole No suppilers available for the product. |
| Name | 2-Chloro-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| Synonyms | 2-Chlor-4-[4-(trifluormethyl)phenyl]-1,3-thiazol; 2-Chloro-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole; 2-Chloro-4-[4-(trifluorométhyl)phényl]-1,3-thiazole |
| Molecular Structure | ![CAS#: 945860-88-8, 2-Chloro-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole](/moreStructures/945860-88-8.gif) |
| Molecular Formula | C10H5ClF3NS |
| Molecular Weight | 263.67 |
| CAS Registry Number | 945860-88-8 |
| SMILES | c1cc(ccc1c2csc(n2)Cl)C(F)(F)F |
| InChI | 1S/C10H5ClF3NS/c11-9-15-8(5-16-9)6-1-3-7(4-2-6)10(12,13)14/h1-5H |
| InChIKey | RZUUMJDXFHDWFC-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.7±52.0°C at 760 mmHg (Cal.) |
| Flash point | 150.2±30.7°C (Cal.) |
| Refractive index | 1.538 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole |