|
CAS#: 946-18-9 Product: 2-(3-Methylbutyl)-1H-Benzimidazole No suppilers available for the product. |
| Name | 2-(3-Methylbutyl)-1H-Benzimidazole |
|---|---|
| Synonyms | 2-Isopentyl-1H-Benzimidazole; 2-Isoamyl-1H-Benzimidazole; 1H-Benzimidazole, 2-(3-Methylbutyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 |
| CAS Registry Number | 946-18-9 |
| SMILES | C2=C1N=C([NH]C1=CC=C2)CCC(C)C |
| InChI | 1S/C12H16N2/c1-9(2)7-8-12-13-10-5-3-4-6-11(10)14-12/h3-6,9H,7-8H2,1-2H3,(H,13,14) |
| InChIKey | WZJCXUYUKDHVTK-UHFFFAOYSA-N |
| Density | 1.059g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.507°C at 760 mmHg (Cal.) |
| Flash point | 178.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Methylbutyl)-1H-Benzimidazole |