|
CAS#: 946-94-1 Product: N-(4-Acetylsulfanylphenyl)acetamide No suppilers available for the product. |
| Name | N-(4-Acetylsulfanylphenyl)acetamide |
|---|---|
| Synonyms | Ethanethioic Acid S-(4-Acetamidophenyl) Ester; Nsc62088 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.26 |
| CAS Registry Number | 946-94-1 |
| SMILES | C1=CC(=CC=C1NC(C)=O)SC(C)=O |
| InChI | 1S/C10H11NO2S/c1-7(12)11-9-3-5-10(6-4-9)14-8(2)13/h3-6H,1-2H3,(H,11,12) |
| InChIKey | DLMPBGQWSCETHR-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.167°C at 760 mmHg (Cal.) |
| Flash point | 202.467°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(4-Acetylsulfanylphenyl)acetamide |