|
CAS#: 946409-15-0 Product: 2-Methyl-2-propanyl 4-{4-[(methylamino)methyl]-2-pyridinyl}-1-piperazinecarboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 4-{4-[(methylamino)methyl]-2-pyridinyl}-1-piperazinecarboxylate |
|---|---|
| Synonyms | tert-buty |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.40 |
| CAS Registry Number | 946409-15-0 |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)c2cc(ccn2)CNC |
| InChI | 1S/C16H26N4O2/c1-16(2,3)22-15(21)20-9-7-19(8-10-20)14-11-13(12-17-4)5-6-18-14/h5-6,11,17H,7-10,12H2,1-4H3 |
| InChIKey | BNLNDKXJNWJYKP-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.246°C at 760 mmHg (Cal.) |
| Flash point | 229.125°C (Cal.) |
| Refractive index | 1.538 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 4-{4-[(methylamino)methyl]-2-pyridinyl}-1-piperazinecarboxylate |