|
CAS#: 947534-45-4 Product: 1-Bromo-2-{[2-(trifluoromethoxy)phenoxy]methyl}benzene No suppilers available for the product. |
| Name | 1-Bromo-2-{[2-(trifluoromethoxy)phenoxy]methyl}benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H10BrF3O2 |
| Molecular Weight | 347.13 |
| CAS Registry Number | 947534-45-4 |
| SMILES | c1ccc(c(c1)COc2ccccc2OC(F)(F)F)Br |
| InChI | 1S/C14H10BrF3O2/c15-11-6-2-1-5-10(11)9-19-12-7-3-4-8-13(12)20-14(16,17)18/h1-8H,9H2 |
| InChIKey | QGOPWPDVVNZLJK-UHFFFAOYSA-N |
| Density | 1.505g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.232°C at 760 mmHg (Cal.) |
| Flash point | 191.31°C (Cal.) |
| Refractive index | 1.538 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-2-{[2-(trifluoromethoxy)phenoxy]methyl}benzene |