|
CAS#: 948-56-1 Product: (p-Tolyl)phenyl sulfoxide No suppilers available for the product. |
| Name | (p-Tolyl)phenyl sulfoxide |
|---|---|
| Synonyms | 1-Methyl-4-Phenylsulfinyl-Benzene; Nsc116694 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.30 |
| CAS Registry Number | 948-56-1 |
| SMILES | C1=CC(=CC=C1C)[S](=O)C2=CC=CC=C2 |
| InChI | 1S/C13H12OS/c1-11-7-9-13(10-8-11)15(14)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | NBNQTORHACKHCW-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.916°C at 760 mmHg (Cal.) |
| Flash point | 176.31°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (p-Tolyl)phenyl sulfoxide |