|
CAS#: 94838-58-1 Product: 2-Methyl-2-propanyl (4-nitrobenzyl)carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl (4-nitrobenzyl)carbamate |
|---|---|
| Synonyms | tert-Butyl 4-nitrobenzylcarbamate; TERT-BUTYL(4-NITROBENZYL)CARBAMATE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 94838-58-1 |
| SMILES | [O-][N+](=O)c1ccc(cc1)CNC(=O)OC(C)(C)C |
| InChI | 1S/C12H16N2O4/c1-12(2,3)18-11(15)13-8-9-4-6-10(7-5-9)14(16)17/h4-7H,8H2,1-3H3,(H,13,15) |
| InChIKey | NXHDMOGWVRMCTL-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.824°C at 760 mmHg (Cal.) |
| Flash point | 201.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl (4-nitrobenzyl)carbamate |