|
CAS#: 948887-38-5 Product: ethyl (E,2S)-2-(tert-butoxycarbonylamino)-5-phenyl-pent-3-enoate No suppilers available for the product. |
| Name | ethyl (E,2S)-2-(tert-butoxycarbonylamino)-5-phenyl-pent-3-enoate |
|---|---|
| Synonyms | (S)-2-ter |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.39 |
| CAS Registry Number | 948887-38-5 |
| SMILES | CCOC(=O)[C@H](/C=C/Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | 1S/C18H25NO4/c1-5-22-16(20)15(19-17(21)23-18(2,3)4)13-9-12-14-10-7-6-8-11-14/h6-11,13,15H,5,12H2,1-4H3,(H,19,21)/b13-9+/t15-/m0/s1 |
| InChIKey | VMNPXKOOBRYPPV-GLNPCMGASA-N |
| Density | 1.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.471°C at 760 mmHg (Cal.) |
| Flash point | 222.004°C (Cal.) |
| Refractive index | 1.513 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ethyl (E,2S)-2-(tert-butoxycarbonylamino)-5-phenyl-pent-3-enoate |