|
CAS#: 95032-39-6 Product: Ethyl acrylate, methacrylic acid copolymer No suppilers available for the product. |
| Name | Ethyl acrylate, methacrylic acid copolymer |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid; Prop-2-Enoic Acid Ethyl Ester; Acrylic Acid Ethyl Ester; Methacrylic Acid; Alcogum L 11 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 95032-39-6 (25212-88-8) |
| SMILES | C(OC(=O)C=C)C.CC(C(=O)O)=C |
| InChI | 1S/C5H8O2.C4H6O2/c1-3-5(6)7-4-2;1-3(2)4(5)6/h3H,1,4H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | GDCRSXZBSIRSFR-UHFFFAOYSA-N |
| Boiling point | 99.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 15.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl acrylate, methacrylic acid copolymer |