|
CAS#: 951-06-4 Product: 5-Methoxy-4,7-phenanthroline No suppilers available for the product. |
| Name | 5-Methoxy-4,7-phenanthroline |
|---|---|
| Synonyms | Nsc142220 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23 |
| CAS Registry Number | 951-06-4 |
| SMILES | C1=C3C(=C2C(=C1OC)N=CC=C2)C=CC=N3 |
| InChI | 1S/C13H10N2O/c1-16-12-8-11-9(4-2-6-14-11)10-5-3-7-15-13(10)12/h2-8H,1H3 |
| InChIKey | MATJLKZMEUUKEN-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.042°C at 760 mmHg (Cal.) |
| Flash point | 133.875°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-4,7-phenanthroline |