|
CAS#: 952665-00-8 Product: methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate No suppilers available for the product. |
| Name | methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate |
|---|---|
| Synonyms | methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 |
| CAS Registry Number | 952665-00-8 |
| SMILES | CC(C)(C)c1cc2cc(cc(c2[nH]1)C(=O)OC)[N+](=O)[O-] |
| InChI | 1S/C14H16N2O4/c1-14(2,3)11-6-8-5-9(16(18)19)7-10(12(8)15-11)13(17)20-4/h5-7,15H,1-4H3 |
| InChIKey | CAMMTUHPGSXTMO-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.117°C at 760 mmHg (Cal.) |
| Flash point | 221.789°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate |