Online Database of Chemicals from Around the World
|
CAS#: 95360-17-1 Product: 1-(2-Quinolyl)-9H-pyrido(3,4-b)indole No suppilers available for the product. |
| Name | 1-(2-Quinolyl)-9H-pyrido(3,4-b)indole |
|---|---|
| Synonyms | 1-(3-Isoquinolyl)-9H-Pyrido[3,4-B]Indole; 1-(3-Isoquinolyl)-9H-$B-Carboline; 1-(2-Quinolyl)-9H-Pyrido(3,4-B)Indole |
| Molecular Structure |  |
| Molecular Formula | C20H13N3 |
| Molecular Weight | 295.34 |
| CAS Registry Number | 95360-17-1 |
| SMILES | C1=CC=C2C(=C1)[NH]C3=C2C=CN=C3C4=NC=C5C(=C4)C=CC=C5 |
| InChI | 1S/C20H13N3/c1-2-6-14-12-22-18(11-13(14)5-1)20-19-16(9-10-21-20)15-7-3-4-8-17(15)23-19/h1-12,23H |
| InChIKey | XCVKCPXFKRDYKB-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.928°C at 760 mmHg (Cal.) |
| Flash point | 266.036°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Quinolyl)-9H-pyrido(3,4-b)indole |