|
CAS#: 954236-28-3 Product: 2-(3-Nitrophenyl)-1,3-oxathiepane No suppilers available for the product. |
| Name | 2-(3-Nitrophenyl)-1,3-oxathiepane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.29 |
| CAS Registry Number | 954236-28-3 |
| SMILES | c1cc(cc(c1)[N+](=O)[O-])C2OCCCCS2 |
| InChI | 1S/C11H13NO3S/c13-12(14)10-5-3-4-9(8-10)11-15-6-1-2-7-16-11/h3-5,8,11H,1-2,6-7H2 |
| InChIKey | BZWGZHJSXCJKOZ-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.947°C at 760 mmHg (Cal.) |
| Flash point | 189.029°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Nitrophenyl)-1,3-oxathiepane |