|
CAS#: 95507-27-0 Product: 7-Diethylamino-4-(Trifluoromethyl)Chromen-2-One No suppilers available for the product. |
| Name | 7-Diethylamino-4-(Trifluoromethyl)Chromen-2-One |
|---|---|
| Synonyms | 7-Diethylamino-4-(Trifluoromethyl)-2-Chromenone; 7-Diethylamino-4-(Trifluoromethyl)Coumarin; Cbdive_008388 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 |
| CAS Registry Number | 95507-27-0 |
| SMILES | C1=CC(=CC2=C1C(=CC(O2)=O)C(F)(F)F)N(CC)CC |
| InChI | 1S/C14H14F3NO2/c1-3-18(4-2)9-5-6-10-11(14(15,16)17)8-13(19)20-12(10)7-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | UIMOXRDVWDLOHW-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.667°C at 760 mmHg (Cal.) |
| Flash point | 167.087°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Diethylamino-4-(Trifluoromethyl)Chromen-2-One |