|
CAS#: 95656-68-1 Product: 1-[4-Amino-3-Chloro-5-(Trifluoromethyl)Phenyl]-2-(2-Methylbutan-2-Ylamino)Ethanol No suppilers available for the product. |
| Name | 1-[4-Amino-3-Chloro-5-(Trifluoromethyl)Phenyl]-2-(2-Methylbutan-2-Ylamino)Ethanol |
|---|---|
| Synonyms | 1-[4-Amino-3-Chloro-5-(Trifluoromethyl)Phenyl]-2-(1,1-Dimethylpropylamino)Ethanol; 1-[4-Amino-3-Chloro-5-(Trifluoromethyl)Phenyl]-2-(Tert-Amylamino)Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20ClF3N2O |
| Molecular Weight | 324.77 |
| CAS Registry Number | 95656-68-1 |
| SMILES | C1=C(C(=C(Cl)C=C1C(O)CNC(CC)(C)C)N)C(F)(F)F |
| InChI | 1S/C14H20ClF3N2O/c1-4-13(2,3)20-7-11(21)8-5-9(14(16,17)18)12(19)10(15)6-8/h5-6,11,20-21H,4,7,19H2,1-3H3 |
| InChIKey | KGOIKOVSEVRHNH-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.848°C at 760 mmHg (Cal.) |
| Flash point | 189.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-Amino-3-Chloro-5-(Trifluoromethyl)Phenyl]-2-(2-Methylbutan-2-Ylamino)Ethanol |