|
CAS#: 958-80-5 Product: 4,4'-Dimethoxythiobenzophenone No suppilers available for the product. |
| Name | 4,4'-Dimethoxythiobenzophenone |
|---|---|
| Synonyms | Nciopen2_006819; 4,4'-Dimethoxythiobenzophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.33 |
| CAS Registry Number | 958-80-5 |
| EINECS | 213-489-2 |
| SMILES | C2=C(C(C1=CC=C(OC)C=C1)=S)C=CC(=C2)OC |
| InChI | 1S/C15H14O2S/c1-16-13-7-3-11(4-8-13)15(18)12-5-9-14(17-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | TUKGAYSGFQWDBC-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.878°C at 760 mmHg (Cal.) |
| Flash point | 186.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dimethoxythiobenzophenone |