|
CAS#: 958452-13-6 Product: 3-[(2-Bromophenyl)sulfanyl]-1,1,1-trifluoro-2-propanol No suppilers available for the product. |
| Name | 3-[(2-Bromophenyl)sulfanyl]-1,1,1-trifluoro-2-propanol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H8BrF3OS |
| Molecular Weight | 301.12 |
| CAS Registry Number | 958452-13-6 |
| SMILES | c1ccc(c(c1)SCC(C(F)(F)F)O)Br |
| InChI | 1S/C9H8BrF3OS/c10-6-3-1-2-4-7(6)15-5-8(14)9(11,12)13/h1-4,8,14H,5H2 |
| InChIKey | BGJIUSWTGXFIOJ-UHFFFAOYSA-N |
| Density | 1.667g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.746°C at 760 mmHg (Cal.) |
| Flash point | 152.621°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(2-Bromophenyl)sulfanyl]-1,1,1-trifluoro-2-propanol |