|
CAS#: 95846-28-9 Product: 1-Chloroestradiol No suppilers available for the product. |
| Name | 1-Chloroestradiol |
|---|---|
| Synonyms | 1-Chloroestradiol; Estra-1,3,5(10)-Triene-3,17-Diol, 1-Chloro-, (17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23ClO2 |
| Molecular Weight | 306.83 |
| CAS Registry Number | 95846-28-9 |
| SMILES | [C@@H]23C1=C(C=C(C=C1CC[C@H]2[C@H]4[C@](CC3)([C@H](CC4)O)C)O)Cl |
| InChI | 1S/C18H23ClO2/c1-18-7-6-13-12(14(18)4-5-16(18)21)3-2-10-8-11(20)9-15(19)17(10)13/h8-9,12-14,16,20-21H,2-7H2,1H3/t12-,13+,14+,16+,18+/m1/s1 |
| InChIKey | CKBZCMHPOSSDAN-PEEYHIECSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.806°C at 760 mmHg (Cal.) |
| Flash point | 230.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloroestradiol |