|
CAS#: 95873-64-6 Product: N-(2-Phenylbutanoyl)-L-methionine No suppilers available for the product. |
| Name | N-(2-Phenylbutanoyl)-L-methionine |
|---|---|
| Synonyms | N-(1-oxo-2-phenylbutyl)-DL-methionine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 |
| CAS Registry Number | 95873-64-6 |
| EINECS | 306-054-4 |
| SMILES | CCC(C(=O)N[C@@H](CCSC)C(O)=O)c1ccccc1 |
| InChI | 1S/C15H21NO3S/c1-3-12(11-7-5-4-6-8-11)14(17)16-13(15(18)19)9-10-20-2/h4-8,12-13H,3,9-10H2,1-2H3,(H,16,17)(H,18,19)/t12?,13-/m0/s1 |
| InChIKey | PPPZIKYQTYHWJF-ABLWVSNPSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.977°C at 760 mmHg (Cal.) |
| Flash point | 280.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Phenylbutanoyl)-L-methionine |