|
CAS#: 959-27-3 Product: (Z)-1,4-Diphenyl-2-butene-1,4-dione No suppilers available for the product. |
| Name | (Z)-1,4-Diphenyl-2-butene-1,4-dione |
|---|---|
| Synonyms | 1,4-Di(Phenyl)But-2-Ene-1,4-Dione; 1,4-Diphenyl-2-Butene-1,4-Dione; 2-Butene-1,4-Dione, 1,4-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 959-27-3 |
| SMILES | C2=C(C(\C=C\C(C1=CC=CC=C1)=O)=O)C=CC=C2 |
| InChI | 1S/C16H12O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
| InChIKey | WYCXGQSQHAXLPK-VAWYXSNFSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 110°C (Expl.) |
| Boiling point | 368.5±38.0°C at 760 mmHg (Cal.) |
| Flash point | 138.2±23.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-1,4-Diphenyl-2-butene-1,4-dione |