|
CAS#: 959-68-2 Product: 6-{[(3-Nitrophenyl)amino]methylene}-2,4-cyclohexadien-1-one No suppilers available for the product. |
| Name | 6-{[(3-Nitrophenyl)amino]methylene}-2,4-cyclohexadien-1-one |
|---|---|
| Synonyms | NSC158144; NSC671630; ZINC00047896 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 |
| CAS Registry Number | 959-68-2 |
| SMILES | O=C\2C(=CNc1cccc([N+]([O-])=O)c1)\C=C/C=C/2 |
| InChI | 1S/C13H10N2O3/c16-13-7-2-1-4-10(13)9-14-11-5-3-6-12(8-11)15(17)18/h1-9,14H |
| InChIKey | NQXFWHBPNKGESE-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.439°C at 760 mmHg (Cal.) |
| Flash point | 203.841°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-{[(3-Nitrophenyl)amino]methylene}-2,4-cyclohexadien-1-one |