Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3,3'-[1,3-Propanediylbis(oxy)]dibenzaldehyde |
|---|---|
| Synonyms | 1,2-Bis(3-formylphenoxy)xylene; 1,3-bis(3-formylphenoxy)propane |
| Molecular Structure | ![CAS#: 95912-31-5, 3,3'-[1,3-Propanediylbis(oxy)]dibenzaldehyde](/moreStructures/95912-31-5.gif) |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 95912-31-5 |
| SMILES | c1cc(cc(c1)OCCCOc2cccc(c2)C=O)C=O |
| InChI | 1S/C17H16O4/c18-12-14-4-1-6-16(10-14)20-8-3-9-21-17-7-2-5-15(11-17)13-19/h1-2,4-7,10-13H,3,8-9H2 |
| InChIKey | CYIKEJAETJNNQZ-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.082°C at 760 mmHg (Cal.) |
| Flash point | 207.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-[1,3-Propanediylbis(oxy)]dibenzaldehyde |