Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Astatech, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 785-3197 | |||
|
sales@astatechinc.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | 2-Methyl-2-propanyl 4-[4-(methylcarbamoyl)phenyl]-1-piperidinecarboxylate |
|---|---|
| Synonyms | 1-N-Boc-4-(4-Methylcarbamoylphenyl)piperidine; 4-(4-Meth |
| Molecular Structure | ![CAS#: 959246-54-9, 2-Methyl-2-propanyl 4-[4-(methylcarbamoyl)phenyl]-1-piperidinecarboxylate](/moreStructures/959246-54-9.gif) |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.41 |
| CAS Registry Number | 959246-54-9 |
| SMILES | CNC(=O)c1ccc(cc1)C2CCN(CC2)C(=O)OC(C)(C)C |
| InChI | 1S/C18H26N2O3/c1-18(2,3)23-17(22)20-11-9-14(10-12-20)13-5-7-15(8-6-13)16(21)19-4/h5-8,14H,9-12H2,1-4H3,(H,19,21) |
| InChIKey | AAEVPDXWHPPQKW-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.106°C at 760 mmHg (Cal.) |
| Flash point | 239.926°C (Cal.) |
| Refractive index | 1.531 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 4-[4-(methylcarbamoyl)phenyl]-1-piperidinecarboxylate |