|
CAS#: 96056-51-8 Product: 2-Benzyl-4-Oxo-5,5,5,-Trifluoropentanoic Acid No suppilers available for the product. |
| Name | 2-Benzyl-4-Oxo-5,5,5,-Trifluoropentanoic Acid |
|---|---|
| Synonyms | 2-(Benzyl)-5,5,5-Trifluoro-4-Keto-Valeric Acid; Botfp; 2-Benzyl-4-Oxo-5,5,5,-Trifluoropentanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 |
| CAS Registry Number | 96056-51-8 |
| SMILES | C1=C(CC(CC(C(F)(F)F)=O)C(=O)O)C=CC=C1 |
| InChI | 1S/C12H11F3O3/c13-12(14,15)10(16)7-9(11(17)18)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,17,18) |
| InChIKey | YFBZRNCKPGDTBO-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.254°C at 760 mmHg (Cal.) |
| Flash point | 164.418°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Benzyl-4-Oxo-5,5,5,-Trifluoropentanoic Acid |