|
CAS#: 96097-14-2 Product: Ammonium 2-(Nonylphenoxy)Ethyl Sulphate No suppilers available for the product. |
| Name | Ammonium 2-(Nonylphenoxy)Ethyl Sulphate |
|---|---|
| Synonyms | Ammonium 2-(2-Nonylphenoxy)Ethyl Sulfate; Ammonium 2-(Nonylphenoxy)Ethyl Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H31NO5S |
| Molecular Weight | 361.50 |
| CAS Registry Number | 96097-14-2 |
| EINECS | 306-093-7 |
| SMILES | C1=C(CCCCCCCCC)C(=CC=C1)OCCO[S]([O-])(=O)=O.[NH4+] |
| InChI | 1S/C17H28O5S.H3N/c1-2-3-4-5-6-7-8-11-16-12-9-10-13-17(16)21-14-15-22-23(18,19)20;/h9-10,12-13H,2-8,11,14-15H2,1H3,(H,18,19,20);1H3 |
| InChIKey | QNYKCQMJRGWFMX-UHFFFAOYSA-N |
| Boiling point | 521.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 269°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2-(Nonylphenoxy)Ethyl Sulphate |