Online Database of Chemicals from Around the World
| No suppilers available for the product. |
| Name | N-n-Propylnorisoapocodeine |
|---|---|
| Synonyms | Pnaic; N-N-Propylnorisoapocodeine |
| Molecular Structure |  |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 |
| CAS Registry Number | 96158-78-0 |
| SMILES | [C@@H]24CC1=CC=C(C(=C1C3=C2C(=CC=C3)CCN4CCC)OC)O |
| InChI | 1S/C20H23NO2/c1-3-10-21-11-9-13-5-4-6-15-18(13)16(21)12-14-7-8-17(22)20(23-2)19(14)15/h4-8,16,22H,3,9-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | HCFIZIBIAJNVGH-MRXNPFEDSA-N |
| Desity | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.695°C at 760 mmHg (Cal.) |
| Flash point | 240.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-n-Propylnorisoapocodeine |