| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 5,11-Dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| Synonyms | (R)-4,12-DIBROMO[2.2]PARACYCLOPHANE |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14Br2 |
| Molecular Weight | 366.09 |
| CAS Registry Number | 96392-77-7 |
| SMILES | C1CC2=C(C=C(CCC3=C(C=C1C=C3)Br)C=C2)Br |
| InChI | 1S/C16H14Br2/c17-15-9-11-1-5-13(15)8-4-12-2-6-14(7-3-11)16(18)10-12/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | QDMAXRJHDMKTQH-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 249-252°C (Expl.) |
| Boiling point | 417.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 241.7±28.0°C (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| IRRITANT | |
| CAUTION: May irritate eyes, skin, and respiratory tract | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5,11-Dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |