|
CAS#: 96446-16-1 Product: 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzimidazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile formate No suppilers available for the product. |
| Name | 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzimidazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile formate |
|---|---|
| Synonyms | 6-chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 |
| CAS Registry Number | 96446-16-1 |
| EINECS | 306-143-8 |
| SMILES | [O-]C=O.CCN(CCC#N)c1ccc(cc1)N=Nc2cc(Cl)cc3c2N(C)C[NH+]3C |
| InChI | 1S/C20H23ClN6.CH2O2/c1-4-27(11-5-10-22)17-8-6-16(7-9-17)23-24-18-12-15(21)13-19-20(18)26(3)14-25(19)2;2-1-3/h6-9,12-13H,4-5,11,14H2,1-3H3;1H,(H,2,3) |
| InChIKey | HRKRVZOWCKCHMY-UHFFFAOYSA-N |
| Boiling point | 682°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 366.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzimidazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile formate |